loading...| Preferred Name |
No preferred name provided for selected language
|
|
| Synonyms |
1,4-Dihydroxybenzene 1,4-Benzenediol p-Hydroquinone Benzene-1,4-diol p-Benzenediol 4-Hydroxyphenol p-hydroxyphenol Eldoquin Quinol Hydroquinone benzene-1,4-diol hydroquinone |
|
| Definitions |
A benzenediol comprising benzene core carrying two hydroxy substituents para to each other. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17594 |
|
| charge |
0 |
|
| definition |
A benzenediol comprising benzene core carrying two hydroxy substituents para to each other. |
|
| formula |
C6H6O2 |
|
| hasAlternativeId |
CHEBI:24645 CHEBI:14416 CHEBI:5793 |
|
| hasDbXref |
KEGG:D00073 PMID:15618234 PMID:24858384 PMID:19148301 Wikipedia:Hydroquinone HMDB:HMDB0002434 MetaCyc:HYDROQUINONE PMID:1395635 Beilstein:605970 Drug_Central:3282 PMID:25586344 PMID:12213471 Reaxys:605970 KNApSAcK:C00002656 CAS:123-31-9 UM-BBD_compID:c0091 Gmelin:2742 PMID:24407054 KEGG:C00530 PMID:1899343 KEGG:C15603 PMID:11170505 PMID:15894107 PPDB:1503 |
|
| hasExactSynonym |
Hydroquinone benzene-1,4-diol hydroquinone |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
1,4-Dihydroxybenzene 1,4-Benzenediol p-Hydroquinone Benzene-1,4-diol p-Benzenediol 4-Hydroxyphenol p-hydroxyphenol Eldoquin Quinol |
|
| id |
CHEBI:17594 |
|
| inchi |
InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H |
|
| inchikey |
QIGBRXMKCJKVMJ-UHFFFAOYSA-N |
|
| inSubset | ||
| label |
hydroquinone hydroquinone |
|
| mass |
110.11064 |
|
| monoisotopicmass |
110.03678 |
|
| notation |
CHEBI:17594 |
|
| smiles |
Oc1ccc(O)cc1 |
|
| subClassOf |