loading...| Preferred Name |
No preferred name provided for selected language
|
|
| Synonyms |
o-carboxyphenol 2-carboxyphenol o-hydroxybenzoic acid 2-HYDROXYBENZOIC ACID o-Hydroxybenzoic acid 2-hydroxybenzoic acid Salicylic acid |
|
| Definitions |
A monohydroxybenzoic acid that is benzoic acid with a hydroxy group at the ortho position. It is obtained from the bark of the white willow and wintergreen leaves. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16914 |
|
| charge |
0 |
|
| definition |
A monohydroxybenzoic acid that is benzoic acid with a hydroxy group at the ortho position. It is obtained from the bark of the white willow and wintergreen leaves. |
|
| formula |
C7H6O3 |
|
| hasAlternativeId |
CHEBI:26597 CHEBI:45521 CHEBI:9006 |
|
| hasDbXref |
PMID:12865403 LINCS:LSM-4763 PMID:1650428 HMDB:HMDB0001895 Reaxys:774890 PMID:29079364 PMID:19400653 KEGG:D00097 PMID:19816125 Wikipedia:Salicylic_Acid PMID:11016405 PMID:32807953 PDBeChem:SAL DrugBank:DB00936 CAS:69-72-7 Drug_Central:2416 MetaCyc:CPD-110 KNApSAcK:C00000206 PMID:3425858 PMID:22770225 KEGG:C00805 Gmelin:3418 Beilstein:774890 |
|
| hasExactSynonym |
2-hydroxybenzoic acid Salicylic acid |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
o-carboxyphenol 2-carboxyphenol o-hydroxybenzoic acid 2-HYDROXYBENZOIC ACID o-Hydroxybenzoic acid |
|
| id |
CHEBI:16914 |
|
| inchi |
InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10) |
|
| inchikey |
YGSDEFSMJLZEOE-UHFFFAOYSA-N |
|
| inSubset | ||
| label |
salicylic acid salicylic acid |
|
| mass |
138.12070 |
|
| monoisotopicmass |
138.03169 |
|
| notation |
CHEBI:16914 |
|
| smiles |
OC(=O)c1ccccc1O |
|
| subClassOf |