Jump to:
loading...| Preferred Name |
No preferred name provided for selected language
|
|
| Synonyms |
2-Aminopropionic acid 2-Aminopropanoic acid A ALA Alanin alanina 2-aminopropanoic acid Alanine alanine |
|
| Definitions |
An alpha-amino acid that consists of propionic acid bearing an amino substituent at position 2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16449 |
|
| charge |
0 |
|
| definition |
An alpha-amino acid that consists of propionic acid bearing an amino substituent at position 2. |
|
| formula |
C3H7NO2 |
|
| hasAlternativeId |
CHEBI:13748 CHEBI:22277 CHEBI:2539 |
|
| hasDbXref |
CAS:302-72-7 Gmelin:2449 Beilstein:635807 PMID:17439666 PMID:22264337 KEGG:C01401 Drug_Central:4306 Wikipedia:Alanine Reaxys:635807 |
|
| hasExactSynonym |
2-aminopropanoic acid Alanine alanine |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
2-Aminopropionic acid 2-Aminopropanoic acid A ALA Alanin alanina |
|
| id |
CHEBI:16449 |
|
| inchi |
InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6) |
|
| inchikey |
QNAYBMKLOCPYGJ-UHFFFAOYSA-N |
|
| inSubset | ||
| label |
alanine alanine |
|
| mass |
89.09322 |
|
| monoisotopicmass |
89.04768 |
|
| notation |
CHEBI:16449 |
|
| smiles |
CC(N)C(O)=O |
|
| subClassOf |