Preferred Name |
No preferred name provided for selected language
|
|
Synonyms |
Cholesterin (3beta,14beta,17alpha)-cholest-5-en-3-ol Cholest-5-en-3beta-ol cholesterol cholest-5-en-3beta-ol CHOLESTEROL Cholesterol |
|
Definitions |
A cholestanoid consisting of cholestane having a double bond at the 5,6-position as well as a 3beta-hydroxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16113 |
|
charge |
0 |
|
definition |
A cholestanoid consisting of cholestane having a double bond at the 5,6-position as well as a 3beta-hydroxy group. |
|
formula |
C27H46O |
|
hasAlternativeId |
CHEBI:13982 CHEBI:41564 CHEBI:23204 CHEBI:3659 |
|
hasDbXref |
HMDB:HMDB0000067 PMID:10901445 PMID:16341241 KEGG:C00187 PMID:25977713 CAS:57-88-5 LIPID_MAPS_instance:LMST01010001 KEGG:D00040 Gmelin:550297 PMID:8838010 KNApSAcK:C00003648 PMID:25451949 PMID:24287311 Reaxys:2060565 PDBeChem:CLR PMID:25522988 DrugBank:DB04540 Wikipedia:Cholesterol PMID:25658343 PMID:25308664 PMID:11412894 MetaCyc:CHOLESTEROL PMID:4696527 Beilstein:2060565 |
|
hasExactSynonym |
cholesterol cholest-5-en-3beta-ol CHOLESTEROL Cholesterol |
|
hasOBONamespace |
chebi_ontology |
|
hasRelatedSynonym |
Cholesterin (3beta,14beta,17alpha)-cholest-5-en-3-ol Cholest-5-en-3beta-ol |
|
id |
CHEBI:16113 |
|
inchi |
InChI=1S/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
|
inchikey |
HVYWMOMLDIMFJA-DPAQBDIFSA-N |
|
inSubset | ||
label |
cholesterol cholesterol |
|
mass |
386.655 |
|
monoisotopicmass |
386.35487 |
|
notation |
CHEBI:16113 |
|
smiles |
C1[C@@]2([C@]3(CC[C@]4([C@]([C@@]3(CC=C2C[C@H](C1)O)[H])(CC[C@@]4([C@H](C)CCCC(C)C)[H])[H])C)[H])C |
|
subClassOf |