Preferred Name |
|
|
Synonyms |
Diclofenac 2-[(2,6-dichlorophenyl)amino]benzeneacetic acid {2-[(2,6-dichlorophenyl)amino]phenyl}acetic acid diclofenac [2-(2,6-dichloroanilino)phenyl]acetic acid diclofenacum diclofenamic acid diclofenaco 2-((2,6-dichlorophenyl)amino)benzeneacetic acid diclofenac acid |
|
Definitions |
A monocarboxylic acid consisting of phenylacetic acid having a (2,6-dichlorophenyl)amino group at the 2-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_47381 |
|
charge |
0 |
|
database_cross_reference |
NCIt:C28985 SNOMEDCT:7034005 MeSH:D004008 KEGG:C01690 Reaxys:2146636 PMID:11322639 Patent:US3558690 PMID:23777257 Drug_Central:865 VSDB:1933 HMDB:HMDB0014724 PDBeChem:DIF PMID:1502708 Wikipedia:Diclofenac Beilstein:2146636 CAS:15307-86-5 KEGG:D07816 PMID:27967303 Patent:NL6604752 LINCS:LSM-2160 PMID:7838674 DrugBank:DB00586 |
|
definition |
A monocarboxylic acid consisting of phenylacetic acid having a (2,6-dichlorophenyl)amino group at the 2-position. |
|
formula |
C14H11Cl2NO2 |
|
has_alternative_id |
CHEBI:4507 CHEBI:47380 |
|
has_exact_synonym |
Diclofenac 2-[(2,6-dichlorophenyl)amino]benzeneacetic acid {2-[(2,6-dichlorophenyl)amino]phenyl}acetic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
diclofenac [2-(2,6-dichloroanilino)phenyl]acetic acid diclofenacum diclofenamic acid diclofenaco 2-((2,6-dichlorophenyl)amino)benzeneacetic acid diclofenac acid |
|
has_role | ||
id |
CHEBI:47381 |
|
in_subset | ||
inchi |
InChI=1S/C14H11Cl2NO2/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h1-7,17H,8H2,(H,18,19) |
|
inchikey |
DCOPUUMXTXDBNB-UHFFFAOYSA-N |
|
label |
diclofenac |
|
mass |
296.150 |
|
monoisotopicmass |
295.01668 |
|
notation |
CHEBI:47381 |
|
smiles |
C1(Cl)=CC=CC(=C1NC2=CC=CC=C2CC(=O)O)Cl |
|
subClassOf |