loading...| Preferred Name |
|
|
| Synonyms |
5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol Resveratrol 3,4',5-Trihydroxystilbene |
|
| Definitions |
A stilbenol that is stilbene in which the phenyl groups are substituted at positions 3, 5, and 4' by hydroxy groups. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27881 |
|
| charge |
0 |
|
| database_cross_reference |
MeSH:C059514 SNOMEDCT:96383001 NCIt:C1215 PMID:12939617 KEGG:C03582 DrugBank:DB02709 LINCS:LSM-2557 Beilstein:1912433 PMID:16461283 CAS:501-36-0 |
|
| definition |
A stilbenol that is stilbene in which the phenyl groups are substituted at positions 3, 5, and 4' by hydroxy groups. |
|
| formula |
C14H12O3 |
|
| has_alternative_id |
CHEBI:1366 CHEBI:11685 CHEBI:19867 |
|
| has_exact_synonym |
5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol Resveratrol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3,4',5-Trihydroxystilbene |
|
| has_role | ||
| id |
CHEBI:27881 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H |
|
| inchikey |
LUKBXSAWLPMMSZ-UHFFFAOYSA-N |
|
| label |
resveratrol |
|
| mass |
228.24328 |
|
| monoisotopicmass |
228.07864 |
|
| notation |
CHEBI:27881 |
|
| smiles |
[H]C(=C([H])c1cc(O)cc(O)c1)c1ccc(O)cc1 |
|
| subClassOf |