Preferred Name | olanzapine | |
Synonyms |
olanzapinum Zyprexa olanzapina olanzapine 2-methyl-4-(4-methylpiperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepine Olanzapine |
|
Definitions |
A benzodiazepine that is 10H-thieno[2,3-b][1,5]benzodiazepine substituted by a methyl group at position 2 and a 4-methylpiperazin-1-yl group at position 4. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7735 |
|
charge |
0 |
|
database_cross_reference |
SNOMEDCT:386849001 PMID:18504690 KEGG:C07322 Wikipedia:Olanzapine Patent:EP454436 Patent:US5229382 CAS:132539-06-1 KEGG:D00454 PMID:18792627 DrugBank:DB00334 MeSH:C076029 SNOMEDCT:108441004 Drug_Central:1982 Reaxys:7655141 NCIt:C47639 PMID:18022155 |
|
definition |
A benzodiazepine that is 10H-thieno[2,3-b][1,5]benzodiazepine substituted by a methyl group at position 2 and a 4-methylpiperazin-1-yl group at position 4. |
|
formula |
C17H20N4S |
|
has characteristic | ||
has_exact_synonym |
2-methyl-4-(4-methylpiperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepine Olanzapine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
olanzapinum Zyprexa olanzapina olanzapine |
|
has_role | ||
id |
CHEBI:7735 |
|
in_subset | ||
inchi |
InChI=1S/C17H20N4S/c1-12-11-13-16(21-9-7-20(2)8-10-21)18-14-5-3-4-6-15(14)19-17(13)22-12/h3-6,11,19H,7-10H2,1-2H3 |
|
inchikey |
KVWDHTXUZHCGIO-UHFFFAOYSA-N |
|
label |
olanzapine |
|
mass |
312.434 |
|
monoisotopicmass |
312.14087 |
|
notation |
CHEBI:7735 |
|
preferred label |
olanzapine |
|
prefLabel |
olanzapine |
|
smiles |
N1=C(C2=C(NC3=CC=CC=C13)SC(=C2)C)N4CCN(CC4)C |
|
subClassOf |