loading...| Preferred Name | nandrolone | |
| Synonyms |
17beta-hydroxy-19-nor-4-androsten-3-one 4-estren-17beta-ol-3-one 17beta-hydroxy-4-estren-3-one 19-Norandrostenolone (17beta)-17-hydroxyestr-4-en-3-one 19-Nortestosterone 17beta-hydroxyestr-4-en-3-one Nandrolone |
|
| Definitions |
A 3-oxo Delta(4)-steroid that is estr-4-en-3-one substituted by a beta-hydroxy group at position 17. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7466 |
|
| charge |
0 |
|
| database_cross_reference |
SNOMEDCT:126171003 PMID:20020363 Drug_Central:1879 Beilstein:2055849 Reaxys:2055849 DrugBank:DB00984 PMID:24405322 MeSH:D009277 CAS:434-22-0 Gmelin:1228044 PMID:11888015 Wikipedia:Nandrolone PMID:19055689 Beilstein:4690380 HMDB:HMDB0002725 KEGG:C07254 KEGG:D08250 NCIt:C29279 VSDB:1861 |
|
| definition |
A 3-oxo Delta(4)-steroid that is estr-4-en-3-one substituted by a beta-hydroxy group at position 17. |
|
| formula |
C18H26O2 |
|
| has characteristic | ||
| has_exact_synonym |
17beta-hydroxyestr-4-en-3-one Nandrolone |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
17beta-hydroxy-19-nor-4-androsten-3-one 4-estren-17beta-ol-3-one 17beta-hydroxy-4-estren-3-one 19-Norandrostenolone (17beta)-17-hydroxyestr-4-en-3-one 19-Nortestosterone 17beta-hydroxyestr-4-en-3-one |
|
| has_role | ||
| id |
CHEBI:7466 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H26O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,13-17,20H,2-9H2,1H3/t13-,14+,15+,16-,17-,18-/m0/s1 |
|
| inchikey |
NPAGDVCDWIYMMC-IZPLOLCNSA-N |
|
| label |
nandrolone |
|
| mass |
274.39780 |
|
| monoisotopicmass |
274.19328 |
|
| notation |
CHEBI:7466 |
|
| preferred label |
nandrolone |
|
| prefLabel |
nandrolone |
|
| smiles |
[H][C@]12CCC(=O)C=C1CC[C@]1([H])[C@]2([H])CC[C@]2(C)[C@@H](O)CC[C@@]12[H] |
|
| subClassOf |