Preferred Name |
|
|
Synonyms |
pregn-4-ene-3,20-dione Progesterone PROGESTERONE progesterone Gelbkoerperhormon Agolutin (S)-4-Pregnene-3,20-dione Crinone luteohormone (S)-Pregn-4-en-3,20-dione Akrolutin Progesteron 4-Pregnene-3,20-dione (S)-Progesterone 17alpha-progesterone Delta(4)-pregnene-3,20-dione corpus luteum hormone |
|
Definitions |
A C21-steroid hormone in which a pregnane skeleton carries oxo substituents at positions 3 and 20 and is unsaturated at C(4)-C(5). As a hormone, it is involved in the female menstrual cycle, pregnancy and embryogenesis of humans and other species. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17026 |
|
charge |
0 |
|
database_cross_reference |
SNOMEDCT:16683002 MeSH:D011374 NCIt:C2297 Wikipedia:Progesterone PMID:10438974 DrugBank:DB00396 Drug_Central:2279 Beilstein:1915950 Reaxys:1915950 PDBeChem:STR PMID:9506942 KEGG:D00066 Gmelin:708590 CAS:57-83-0 HMDB:HMDB0001830 KEGG:C00410 MetaCyc:PROGESTERONE |
|
definition |
A C21-steroid hormone in which a pregnane skeleton carries oxo substituents at positions 3 and 20 and is unsaturated at C(4)-C(5). As a hormone, it is involved in the female menstrual cycle, pregnancy and embryogenesis of humans and other species. |
|
formula |
C21H30O2 |
|
has_alternative_id |
CHEBI:8453 CHEBI:439 CHEBI:26269 CHEBI:14896 CHEBI:18798 CHEBI:45786 |
|
has_exact_synonym |
pregn-4-ene-3,20-dione Progesterone PROGESTERONE progesterone |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Gelbkoerperhormon Agolutin (S)-4-Pregnene-3,20-dione Crinone luteohormone (S)-Pregn-4-en-3,20-dione Akrolutin Progesteron 4-Pregnene-3,20-dione (S)-Progesterone 17alpha-progesterone Delta(4)-pregnene-3,20-dione corpus luteum hormone |
|
has_role | ||
id |
CHEBI:17026 |
|
in_subset | ||
inchi |
InChI=1S/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11H2,1-3H3/t16-,17+,18-,19-,20-,21+/m0/s1 |
|
inchikey |
RJKFOVLPORLFTN-LEKSSAKUSA-N |
|
label |
progesterone |
|
mass |
314.46170 |
|
monoisotopicmass |
314.22458 |
|
notation |
CHEBI:17026 |
|
smiles |
[H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])C(C)=O |
|
subClassOf |