Preferred Name |
tyrosine |
|
Synonyms |
|
|
ID |
http://purl.obolibrary.org/obo/CHEBI_18186 |
|
altId |
CHEBI:27176 CHEBI:9800 CHEBI:15277 |
|
Definition |
An alpha-amino acid that is phenylalanine bearing a hydroxy substituent at position 4 on the phenyl ring. |
|
InChI |
InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13) |
|
InChIKey |
InChIKey=OUYCCCASQSFEME-UHFFFAOYSA-N |
|
label |
tyrosine |
|
prefixIRI |
obo2:CHEBI_18186 |
|
prefLabel |
tyrosine |
|
SMILES |
NC(Cc1ccc(O)cc1)C(O)=O |
|
Synonym |
Tyrosine Y 2-amino-3-(4-hydroxyphenyl)propanoic acid tyrosine 3-(p-Hydroxyphenyl)alanine C9H11NO3 2-Amino-3-(p-hydroxyphenyl)propionic acid Tyr Tyrosin tirosina |
|
xref |
KEGG COMPOUND:C01536 Gmelin:27744 ChemIDplus:55520-40-6 KEGG COMPOUND:556-03-6 Reaxys:515881 KNApSAcK:C00001397 Beilstein:515881 CiteXplore:17190852 |
|
subClassOf |
Create mapping