Preferred Name | phenylalanine | |
Synonyms |
|
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28044 |
|
altId |
CHEBI:8089 CHEBI:25984 |
|
Definition |
An aromatic amino acid that is alanine in which one of the methyl hydrogens is substituted by a phenyl group. |
|
InChI |
InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) |
|
InChIKey |
InChIKey=COLNVLDHVKWLRT-UHFFFAOYSA-N |
|
label |
phenylalanine |
|
prefixIRI |
obo2:CHEBI_28044 |
|
prefLabel |
phenylalanine |
|
SMILES |
NC(Cc1ccccc1)C(O)=O |
|
Synonym |
PHE Phenylalanin DL-Phenylalanine alpha-Amino-beta-phenylpropionic acid Phenylalanine F fenilalanina 2-amino-3-phenylpropanoic acid phenylalanine C9H11NO2 |
|
xref |
Beilstein:1910407 Gmelin:50836 NIST Chemistry WebBook:150-30-1 Wikipedia:Phenylalanine ChemIDplus:150-30-1 CiteXplore:17439666 Reaxys:1910407 CiteXplore:22264337 KEGG COMPOUND:C02057 |
|
subClassOf |
Create mapping