Preferred Name |
ifosfamide |
|
Synonyms |
|
|
Definitions |
A nitrogen mustard alkylating agent used in the treatment of cancer |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5864 |
|
alternative term |
InChIKey=HOMGKSMUEGBAAB-UHFFFAOYSA-N ifosfamidum ifosfamide ClCCNP1(=O)OCCCN1CCCl ifosfamida 3-(2-chloroethyl)-2-((2-chloroethyl)amino)tetrahydro-2H-1,3,2-oxazaphosphorine 2-oxide Isophosphamide isosfamide Iphosphamide N,3-bis(2-chloroethyl)-1,3,2-oxazaphosphinan-2-amine 2-oxide InChI=1S/C7H15Cl2N2O2P/c8-2-4-10-14(12)11(6-3-9)5-1-7-13-14/h1-7H2,(H,10,12) C7H15Cl2N2O2P Isofosfamide |
|
definition |
A nitrogen mustard alkylating agent used in the treatment of cancer |
|
label |
ifosfamide |
|
prefixIRI |
CHEBI:5864 |
|
prefLabel |
ifosfamide |
|
subClassOf |
Create mapping