Preferred Name |
anthralin |
|
Synonyms |
|
|
Definitions |
A tricyclic aromatic compound derived from anthracene by the substitution of -OH groups for hydrogen at C-1 and C-8, and for an oxo group at C-9. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_37510 |
|
alternative term |
dithranol InChIKey=NUZWLKWWNNJHPT-UHFFFAOYSA-N Oc1cccc2Cc3cccc(O)c3C(=O)c12 InChI=1S/C14H10O3/c15-10-5-1-3-8-7-9-4-2-6-11(16)13(9)14(17)12(8)10/h1-6,15-16H,7H2 1,8-dihydroxy-9-anthrone 1,8-dihydroxyanthrone 1,8-dihydroxy-9(10H)-anthracenone C14H10O3 1,8-dihydroxyanthracen-9(10H)-one |
|
definition |
A tricyclic aromatic compound derived from anthracene by the substitution of -OH groups for hydrogen at C-1 and C-8, and for an oxo group at C-9. |
|
has functional parent | ||
is tautomer of | ||
label |
anthralin |
|
prefixIRI |
CHEBI:37510 |
|
prefLabel |
anthralin |
|
subClassOf |
Create mapping