Preferred Name |
aspartame |
|
Synonyms |
|
|
Definitions |
A dipeptide that has formula C14H18N2O5. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_2877 |
|
alternative term |
C14H18N2O5 Aspartame Aspartylphenylalanine methyl ester 1-methyl N-L-alpha-aspartyl-L-phenylalanate aspartam 3-Amino-N-(alpha-carboxyphenethyl)succinamic acid N-methyl ester COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)CC(O)=O aspartame Asp-phe-ome methyl L-alpha-aspartyl-L-phenylalaninate aspartamum L-Aspartyl-L-phenylalanine methyl ester InChI=1S/C14H18N2O5/c1-21-14(20)11(7-9-5-3-2-4-6-9)16-13(19)10(15)8-12(17)18/h2-6,10-11H,7-8,15H2,1H3,(H,16,19)(H,17,18)/t10-,11-/m0/s1 InChIKey=IAOZJIPTCAWIRG-QWRGUYRKSA-N aspartamo 3-Amino-N-(alpha-methoxycarbonylphenethyl) succinamic acid |
|
definition |
A dipeptide that has formula C14H18N2O5. |
|
has role | ||
label |
aspartame |
|
prefixIRI |
CHEBI:2877 |
|
prefLabel |
aspartame |
|
subClassOf |
Create mapping