Preferred Name |
cystine |
|
Synonyms |
|
|
Definitions |
A sulfur-containing amino acid that has formula C6H12N2O4S2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17376 |
|
alternative term |
Zystin InChIKey=LEVWYRKDKASIDU-UHFFFAOYSA-N C6H12N2O4S2 3,3'-disulfanediylbis(2-aminopropanoic acid) 3,3'-dithiobis(2-aminopropanoic acid) InChI=1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12) Cystine cystine NC(CSSCC(N)C(O)=O)C(O)=O Dicysteine cistina alpha-Diamino-beta-dithiolactic acid Cystin |
|
definition |
A sulfur-containing amino acid that has formula C6H12N2O4S2. |
|
is tautomer of | ||
label |
cystine |
|
prefixIRI |
CHEBI:17376 |
|
prefLabel |
cystine |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_23509 |
Create mapping