Preferred Name |
biotin |
|
Synonyms |
|
|
Definitions |
A member of the biotins that has formula C10H16N2O3S. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15956 |
|
alternative term |
D-(+)-biotin [H][C@]12CS[C@@H](CCCCC(O)=O)[C@@]1([H])NC(=O)N2 InChI=1S/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7-,9-/m0/s1 InChIKey=YBJHBAHKTGYVGT-ZKWXMUAHSA-N C10H16N2O3S vitamin B7 Vitamin H BIOTIN D-Biotin biotina Biotin 5-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoic acid biotine biotinum Coenzyme R |
|
definition |
A member of the biotins that has formula C10H16N2O3S. |
|
has role | ||
is conjugate acid of | ||
label |
biotin |
|
prefixIRI |
CHEBI:15956 |
|
prefLabel |
biotin |
|
subClassOf |
Create mapping