Preferred Name |
tyramine |
|
Synonyms |
|
|
Definitions |
The primary amine obtained from decarboxylation of the amino acid tyrosine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15760 |
|
alternative term |
4-(2-aminoethyl)phenol NCCc1ccc(O)cc1 Tyramin InChI=1S/C8H11NO/c9-6-5-7-1-3-8(10)4-2-7/h1-4,10H,5-6,9H2 InChIKey=DZGWFCGJZKJUFP-UHFFFAOYSA-N Tyramine 2-(p-Hydroxyphenyl)ethylamine C8H11NO |
|
definition |
The primary amine obtained from decarboxylation of the amino acid tyrosine. |
|
has role | ||
is conjugate base of | ||
label |
tyramine |
|
prefixIRI |
CHEBI:15760 |
|
prefLabel |
tyramine |
|
subClassOf |
Create mapping