loading...| Preferred Name |
dipivefrin |
|
| Synonyms |
|
|
| Definitions |
The dipivalate ester of (+-)-epinephrine (racepinephrine). A pro-drug of epinephrine, the hydrochloride is used topically as eye drops to reduce intra-ocular pressure in the treatment of open-angle glaucoma or ocular hypertension. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4646 |
|
| alternative term |
(+-)-4-[1-hydroxy-2-(methylamino)ethyl]-o-phenylene divavalate Dipivefrin InChIKey=OCUJLLGVOUDECM-UHFFFAOYSA-N dipivefrina Dipivefrine C19H29NO5 dipivefrinum dipivefrine CNCC(O)c1ccc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c1 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diyl bis(2,2-dimethylpropanoate) dipivalyl epinephrine InChI=1S/C19H29NO5/c1-18(2,3)16(22)24-14-9-8-12(13(21)11-20-7)10-15(14)25-17(23)19(4,5)6/h8-10,13,20-21H,11H2,1-7H3 4-[1-hydroxy-2-(methylamino)ethyl]-o-phenylene divavalate 1-(3',4'-dipivaloyloxyphenyl)-2-methylamino-1-ethanol |
|
| definition |
The dipivalate ester of (+-)-epinephrine (racepinephrine). A pro-drug of epinephrine, the hydrochloride is used topically as eye drops to reduce intra-ocular pressure in the treatment of open-angle glaucoma or ocular hypertension. |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_39456 http://purl.obolibrary.org/obo/CHEBI_35524 |
|
| label |
dipivefrin |
|
| prefixIRI |
CHEBI:4646 |
|
| prefLabel |
dipivefrin |
|
| subClassOf |