Jump to:
loading...| Preferred Name | lactate | |
| Synonyms |
|
|
| Definitions |
A hydroxy monocarboxylic acid anion that has formula C3H5O3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_24996 |
|
| alternative term |
CC(O)C([O-])=O 2-hydroxypropionate C3H5O3 InChIKey=JVTAAEKCZFNVCJ-UHFFFAOYSA-M 2-hydroxypropanoic acid, ion(1-) InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/p-1 MeCH(OH)CO2 anion 2-hydroxypropanoate |
|
| definition |
A hydroxy monocarboxylic acid anion that has formula C3H5O3. |
|
| has functional parent | ||
| is conjugate base of | ||
| label |
lactate |
|
| prefixIRI |
CHEBI:24996 |
|
| prefLabel |
lactate |
|
| subClassOf |
Create mapping