Preferred Name | ornithine | |
Synonyms |
|
|
Definitions |
An alpha-amino acid that has formula C5H12N2O2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_18257 |
|
alternative term |
Ornithine C5H12N2O2 Orn InChIKey=AHLPHDHHMVZTML-UHFFFAOYSA-N InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9) 2,5-Diaminovaleric acid 2,5-diaminopentanoic acid 2,5-Diaminopentanoic acid ornithine NCCCC(N)C(O)=O |
|
definition |
An alpha-amino acid that has formula C5H12N2O2. |
|
is conjugate acid of | ||
is conjugate base of | ||
label |
ornithine |
|
prefixIRI |
CHEBI:18257 |
|
prefLabel |
ornithine |
|
subClassOf |
Create mapping