loading...| Preferred Name | benzylpenicillin | |
| Synonyms |
|
|
| Definitions |
A penicillin in which the substituent at position 6 of the penam ring is a phenylacetamido group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18208 |
|
| alternative term |
free penicillin II bencilpenicilina 6-(2-phenylacetamido)penicillanic acid InChIKey=JGSARLDLIJGVTE-MBNYWOFBSA-N C16H18N2O4S Benzylpenicillin 2,2-dimethyl-6beta-(phenylacetamido)penam-3alpha-carboxylic acid PENICILLIN G benzylpenicilline Penicillin G benzylpenicillinic acid PG InChI=1S/C16H18N2O4S/c1-16(2)12(15(21)22)18-13(20)11(14(18)23-16)17-10(19)8-9-6-4-3-5-7-9/h3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22)/t11-,12+,14-/m1/s1 (2S,5R,6R)-3,3-dimethyl-7-oxo-6-(phenylacetamido)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid benzylpenicillinum [H][C@]12SC(C)(C)[C@@H](N1C(=O)[C@H]2NC(=O)Cc1ccccc1)C(O)=O benzylpenicillin |
|
| definition |
A penicillin in which the substituent at position 6 of the penam ring is a phenylacetamido group. |
|
| is conjugate acid of | ||
| label |
benzylpenicillin |
|
| prefixIRI |
CHEBI:18208 |
|
| prefLabel |
benzylpenicillin |
|
| subClassOf |