Jump to:
loading...| Preferred Name | glycolic acid | |
| Synonyms |
|
|
| Definitions |
A 2-hydroxy monocarboxylic acid that has formula C2H4O3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17497 |
|
| alternative term |
C2H4O3 InChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5) Glycolic acid Hydroxyacetic acid InChIKey=AEMRFAOFKBGASW-UHFFFAOYSA-N GLYCOLIC ACID hydroxyacetic acid OCC(O)=O |
|
| definition |
A 2-hydroxy monocarboxylic acid that has formula C2H4O3. |
|
| has functional parent | ||
| is conjugate acid of | ||
| label |
glycolic acid |
|
| prefixIRI |
CHEBI:17497 |
|
| prefLabel |
glycolic acid |
|
| subClassOf |
Create mapping