Preferred Name | methionine | |
Synonyms |
|
|
Definitions |
A sulfur-containing amino acid that has formula C5H11NO2S. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16811 |
|
alternative term |
CSCCC(N)C(O)=O 2-amino-4-(methylsulfanyl)butanoic acid Hmet Methionin C5H11NO2S metionina Methionine alpha-amino-gamma-methylmercaptobutyric acid InChIKey=FFEARJCKVFRZRR-UHFFFAOYSA-N 2-Amino-4-(methylthio)butyric acid methionine 2-amino-4-(methylthio)butanoic acid InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
|
definition |
A sulfur-containing amino acid that has formula C5H11NO2S. |
|
has functional parent | ||
has part | ||
is conjugate acid of | ||
is conjugate base of | ||
label |
methionine |
|
prefixIRI |
CHEBI:16811 |
|
prefLabel |
methionine |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26834 http://purl.obolibrary.org/obo/CHEBI_33704 |
Create mapping