Jump to:
loading...| Preferred Name |
L-methionine |
|
| Synonyms |
|
|
| Definitions |
The L-enantiomer of methionine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16643 |
|
| alternative term |
(S)-2-amino-4-(methylthio)butanoic acid METHIONINE (2S)-2-amino-4-(methylsulfanyl)butanoic acid L-Methionine L-(-)-methionine L-Methionin L-methionine CSCC[C@H](N)C(O)=O (S)-methionine L-alpha-amino-gamma-methylmercaptobutyric acid C5H11NO2S InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 M InChIKey=FFEARJCKVFRZRR-BYPYZUCNSA-N Met (S)-2-amino-4-(methylthio)butyric acid |
|
| definition |
The L-enantiomer of methionine. |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-methionine |
|
| prefixIRI |
CHEBI:16643 |
|
| prefLabel |
L-methionine |
|
| subClassOf |
Create mapping