Jump to:
loading...| Preferred Name | 1,4-benzoquinone | |
| Synonyms |
|
|
| Definitions |
Aromatic compound comprising benzene core carrying two ketone substituents para to each other. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16509 |
|
| alternative term |
1,4-benzoquinone Quinone O=C1C=CC(=O)C=C1 InChI=1S/C6H4O2/c7-5-1-2-6(8)4-3-5/h1-4H 2,5-Cyclohexadiene-1,4-dione benzoquinone p-Chinon InChIKey=AZQWKYJCGOJGHM-UHFFFAOYSA-N p-Benzoquinone C6H4O2 cyclohexa-2,5-diene-1,4-dione benzo-1,4-quinone 1,4-Benzochinon |
|
| definition |
Aromatic compound comprising benzene core carrying two ketone substituents para to each other. |
|
| label |
1,4-benzoquinone |
|
| prefixIRI |
CHEBI:16509 |
|
| prefLabel |
1,4-benzoquinone |
|
| subClassOf |
Create mapping