loading...| Preferred Name | oxiconazole | |
| Synonyms |
2',4'-Dichloro-2-imidazol-1-ylacetophenone (Z)-[O-(2,4-dichlorobenzyl)oxime] oxiconazole oxiconazolum Ro 13-8996 oxiconazol (1Z)-N-[(2,4-dichlorobenzyl)oxy]-1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethanimine |
|
| Definitions |
An oxime O-ether that is the 2,4-dichlorobenzyl ether of the oxime obtained by formal condensation of hydroxylamine with the carbonyl group of acetopnenone in which the phenyl group is substituted by chlorines at positions 2 and 4, and in which one of the hydrogens of the methyl group is replaced by a 1H-imidazol-1-yl group. An antifungal agent, it is used (generally as the nitrate salt) in creams and powders for the topical treatment of fungal skin infections. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7825 |
|
| alternative term |
2',4'-Dichloro-2-imidazol-1-ylacetophenone (Z)-[O-(2,4-dichlorobenzyl)oxime] oxiconazole oxiconazolum Ro 13-8996 oxiconazol (1Z)-N-[(2,4-dichlorobenzyl)oxy]-1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethanimine |
|
| charge |
0 |
|
| database_cross_reference |
PMID:2793313 Patent:US4550175 Reaxys:6004213 PMID:7037014 Drug_Central:3408 CAS:64211-45-6 Wikipedia:Oxiconazole PMID:23482479 PMID:22569007 HMDB:HMDB0014384 DrugBank:DB00239 PMID:15797782 KEGG:C08074 KEGG:D08313 PMID:2029718 |
|
| definition |
An oxime O-ether that is the 2,4-dichlorobenzyl ether of the oxime obtained by formal condensation of hydroxylamine with the carbonyl group of acetopnenone in which the phenyl group is substituted by chlorines at positions 2 and 4, and in which one of the hydrogens of the methyl group is replaced by a 1H-imidazol-1-yl group. An antifungal agent, it is used (generally as the nitrate salt) in creams and powders for the topical treatment of fungal skin infections. |
|
| formula |
C18H13Cl4N3O |
|
| has_exact_synonym |
(1Z)-N-[(2,4-dichlorobenzyl)oxy]-1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethanimine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2',4'-Dichloro-2-imidazol-1-ylacetophenone (Z)-[O-(2,4-dichlorobenzyl)oxime] oxiconazole oxiconazolum Ro 13-8996 oxiconazol |
|
| id |
CHEBI:7825 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H13Cl4N3O/c19-13-2-1-12(16(21)7-13)10-26-24-18(9-25-6-5-23-11-25)15-4-3-14(20)8-17(15)22/h1-8,11H,9-10H2/b24-18+ |
|
| inchikey |
QRJJEGAJXVEBNE-HKOYGPOVSA-N |
|
| is_conjugate_base_of | ||
| label |
oxiconazole |
|
| mass |
429.12700 |
|
| monoisotopicmass |
426.98127 |
|
| notation |
CHEBI:7825 |
|
| prefLabel |
oxiconazole |
|
| smiles |
Clc1ccc(CO\N=C(/Cn2ccnc2)c2ccc(Cl)cc2Cl)c(Cl)c1 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36816 http://purl.obolibrary.org/obo/CHEBI_87069 |