loading...| Preferred Name | 2-hydroxy-3-(2-methoxyphenoxy)propyl carbamate | |
| Synonyms |
2-hydroxy-3-(2-methoxyphenoxy)propyl carbamate |
|
| Definitions |
A carbamate ester that is glycerol in which one of the primary alcohol groups has been converted to its 2-methoxyphenyl ether while the other has been converted to the corresponding carbamate ester. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_77498 |
|
| alternative term |
2-hydroxy-3-(2-methoxyphenoxy)propyl carbamate |
|
| charge |
0 |
|
| database_cross_reference |
LINCS:LSM-1453 |
|
| definition |
A carbamate ester that is glycerol in which one of the primary alcohol groups has been converted to its 2-methoxyphenyl ether while the other has been converted to the corresponding carbamate ester. |
|
| formula |
C11H15NO5 |
|
| has_exact_synonym |
2-hydroxy-3-(2-methoxyphenoxy)propyl carbamate |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:77498 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H15NO5/c1-15-9-4-2-3-5-10(9)16-6-8(13)7-17-11(12)14/h2-5,8,13H,6-7H2,1H3,(H2,12,14) |
|
| inchikey |
GNXFOGHNGIVQEH-UHFFFAOYSA-N |
|
| label |
2-hydroxy-3-(2-methoxyphenoxy)propyl carbamate |
|
| mass |
241.24050 |
|
| monoisotopicmass |
241.09502 |
|
| notation |
CHEBI:77498 |
|
| prefLabel |
2-hydroxy-3-(2-methoxyphenoxy)propyl carbamate |
|
| smiles |
COc1ccccc1OCC(O)COC(N)=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 |