Preferred Name | 2-hydroxy-3-(2-methoxyphenoxy)propyl carbamate | |
Synonyms |
2-hydroxy-3-(2-methoxyphenoxy)propyl carbamate |
|
Definitions |
A carbamate ester that is glycerol in which one of the primary alcohol groups has been converted to its 2-methoxyphenyl ether while the other has been converted to the corresponding carbamate ester. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_77498 |
|
alternative term |
2-hydroxy-3-(2-methoxyphenoxy)propyl carbamate |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-1453 |
|
definition |
A carbamate ester that is glycerol in which one of the primary alcohol groups has been converted to its 2-methoxyphenyl ether while the other has been converted to the corresponding carbamate ester. |
|
formula |
C11H15NO5 |
|
has_exact_synonym |
2-hydroxy-3-(2-methoxyphenoxy)propyl carbamate |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:77498 |
|
in_subset | ||
inchi |
InChI=1S/C11H15NO5/c1-15-9-4-2-3-5-10(9)16-6-8(13)7-17-11(12)14/h2-5,8,13H,6-7H2,1H3,(H2,12,14) |
|
inchikey |
GNXFOGHNGIVQEH-UHFFFAOYSA-N |
|
label |
2-hydroxy-3-(2-methoxyphenoxy)propyl carbamate |
|
mass |
241.24050 |
|
monoisotopicmass |
241.09502 |
|
notation |
CHEBI:77498 |
|
prefLabel |
2-hydroxy-3-(2-methoxyphenoxy)propyl carbamate |
|
smiles |
COc1ccccc1OCC(O)COC(N)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 |