Link to this page
Biological and Environmental Research Ontology
| Preferred Name | aminophylline | |
| Synonyms |
Theophyllaminium Aminocardol Rectalad aminophylline theophylline, compd with ethylenediamine (2:1) Neophyiline Metaphyllin Cardophyllin Theophylline ethylenediamine Theophyllamine Truphylline Euphyllinum Aminofillina Theophyllin aethylendiamin Variaphylline Somophyllin ethylenediamine, compd. with theophylline (1:2) Syntophyllin Peterphyllin Theophyline ethylenediamine Methophylline aminophyllinum Thephyldine 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compd with 1,2-ethanediamine (2:1) Diuxanthine theophyline ethylenediamine Aminodur dura-tabs Theophyllaminum Neophylline Theophyldine Ethophylline Inophylline Metaphylline Etilen-Xantisan Diaphilline aminophylline Phyllocontin Genophyllin Diaphylline Cardiofilina Aminophyllin Cardophylin aminofilina Aminodur BY 108 Cardiomin Carena Cariomin Diophllin Diophyllin Dobo Eufilina Euphyllin Euphylline Eurphyllin Euufilin Euufillin Grifomin Lasodex Linampheta Lixaminol Minaphil Miofilin Norofilina Phylcardin Phyllindon Stenovasan TAD TH/100 Tefamin Theodrox Theolamine Theolone Theomin Vasofilina 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - ethane-1,2-diamine (2:1) Aminophylline |
|
| Definitions |
A mixture comprising of theophylline and ethylenediamine in a 2:1 ratio. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2659 |
|
| alternative term |
Theophyllaminium Aminocardol Rectalad aminophylline theophylline, compd with ethylenediamine (2:1) Neophyiline Metaphyllin Cardophyllin Theophylline ethylenediamine Theophyllamine Truphylline Euphyllinum Aminofillina Theophyllin aethylendiamin Variaphylline Somophyllin ethylenediamine, compd. with theophylline (1:2) Syntophyllin Peterphyllin Theophyline ethylenediamine Methophylline aminophyllinum Thephyldine 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compd with 1,2-ethanediamine (2:1) Diuxanthine theophyline ethylenediamine Aminodur dura-tabs Theophyllaminum Neophylline Theophyldine Ethophylline Inophylline Metaphylline Etilen-Xantisan Diaphilline aminophylline Phyllocontin Genophyllin Diaphylline Cardiofilina Aminophyllin Cardophylin aminofilina Aminodur BY 108 Cardiomin Carena Cariomin Diophllin Diophyllin Dobo Eufilina Euphyllin Euphylline Eurphyllin Euufilin Euufillin Grifomin Lasodex Linampheta Lixaminol Minaphil Miofilin Norofilina Phylcardin Phyllindon Stenovasan TAD TH/100 Tefamin Theodrox Theolamine Theolone Theomin Vasofilina 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - ethane-1,2-diamine (2:1) Aminophylline
|
|
| bearer of | ||
| charge |
0
|
|
| database_cross_reference |
PMID:12615581 PMID:17391155 PMID:30797981 KEGG:D00227 PMID:21223510 PMID:14608279 CAS:317-34-0 PMID:2636295 PMID:20206069 Wikipedia:Aminophylline PMID:10654755 PMID:18568240 DrugBank:DB01223 PMID:31122698
|
|
| definition |
A mixture comprising of theophylline and ethylenediamine in a 2:1 ratio.
|
|
| formula |
C7H8N4O2.C7H8N4O2.C2H8N2
|
|
| has part | ||
| has_exact_synonym |
1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - ethane-1,2-diamine (2:1) Aminophylline
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
Theophyllaminium Aminocardol Rectalad aminophylline theophylline, compd with ethylenediamine (2:1) Neophyiline Metaphyllin Cardophyllin Theophylline ethylenediamine Theophyllamine Truphylline Euphyllinum Aminofillina Theophyllin aethylendiamin Variaphylline Somophyllin ethylenediamine, compd. with theophylline (1:2) Syntophyllin Peterphyllin Theophyline ethylenediamine Methophylline aminophyllinum Thephyldine 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compd with 1,2-ethanediamine (2:1) Diuxanthine theophyline ethylenediamine Aminodur dura-tabs Theophyllaminum Neophylline Theophyldine Ethophylline Inophylline Metaphylline Etilen-Xantisan Diaphilline aminophylline Phyllocontin Genophyllin Diaphylline Cardiofilina Aminophyllin Cardophylin aminofilina Aminodur BY 108 Cardiomin Carena Cariomin Diophllin Diophyllin Dobo Eufilina Euphyllin Euphylline Eurphyllin Euufilin Euufillin Grifomin Lasodex Linampheta Lixaminol Minaphil Miofilin Norofilina Phylcardin Phyllindon Stenovasan TAD TH/100 Tefamin Theodrox Theolamine Theolone Theomin Vasofilina
|
|
| id |
CHEBI:2659
|
|
| in_subset | ||
| inchi |
InChI=1S/2C7H8N4O2.C2H8N2/c2*1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2-4/h2*3H,1-2H3,(H,8,9);1-4H2
|
|
| inchikey |
FQPFAHBPWDRTLU-UHFFFAOYSA-N
|
|
| label |
aminophylline
|
|
| mass |
420.434
|
|
| monoisotopicmass |
420.19820
|
|
| notation |
CHEBI:2659
|
|
| overlaps | ||
| prefLabel |
aminophylline
|
|
| RO_0000087 | ||
| smiles |
C(CN)N.C12=C(N(C(=O)N(C1=O)C)C)N=CN2.C12=C(N(C(N(C1=O)C)=O)C)N=CN2
|
|
| subClassOf |
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |