Preferred Name |
L-methionine |
|
Synonyms |
L-methionine L-Methionine (2S)-2-amino-4-(methylsulfanyl)butanoic acid (S)-2-amino-4-(methylthio)butyric acid (S)-2-amino-4-(methylthio)butanoic acid (S)-methionine L-alpha-amino-gamma-methylmercaptobutyric acid L-(-)-methionine L-Methionin M METHIONINE Met Methionine |
|
Definitions |
The L-enantiomer of methionine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16643 |
|
charge |
0 |
|
database_cross_reference |
PMID:24126240 PMID:22200379 MetaCyc:MET HMDB:HMDB0000696 PMID:5764336 KNApSAcK:C00001379 YMDB:YMDB00318 KEGG:C00073 PMID:24939187 CAS:63-68-3 PMID:21946918 DrugBank:DB00134 PMID:22517898 PMID:16575097 PMID:22448874 ECMDB:ECMDB00696 PDBeChem:MET_LFOH Drug_Central:3347 KEGG:D00019 Reaxys:1722294 Gmelin:26935 PMID:22370952 PMID:21683740 |
|
definition |
The L-enantiomer of methionine. |
|
formula |
C5H11NO2S |
|
has_alternative_id |
CHEBI:21360 CHEBI:13141 CHEBI:43990 CHEBI:6271 |
|
has_exact_synonym |
L-methionine L-Methionine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(2S)-2-amino-4-(methylsulfanyl)butanoic acid (S)-2-amino-4-(methylthio)butyric acid (S)-2-amino-4-(methylthio)butanoic acid (S)-methionine L-alpha-amino-gamma-methylmercaptobutyric acid L-(-)-methionine L-Methionin M METHIONINE Met Methionine |
|
id |
CHEBI:16643 |
|
in_subset | ||
inchi |
InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
|
inchikey |
FFEARJCKVFRZRR-BYPYZUCNSA-N |
|
is_conjugate_acid_of | ||
is_conjugate_base_of | ||
is_enantiomer_of | ||
is_tautomer_of | ||
label |
L-methionine |
|
mass |
149.21238 |
|
monoisotopicmass |
149.05105 |
|
notation |
CHEBI:16643 |
|
prefLabel |
L-methionine |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_74529 http://purl.obolibrary.org/obo/CHEBI_75771 |
|
smiles |
CSCC[C@H](N)C(O)=O |
|
subClassOf |