loading...| Preferred Name | L-ornithine | |
| Synonyms |
(S)-ornithine (S)-2,5-Diaminopentanoate (S)-2,5-Diaminopentanoic acid (S)-alpha,delta-diaminovaleric acid (S)-2,5-diaminovaleric acid L-ornithine (2S)-2,5-diaminopentanoic acid L-Ornithine |
|
| Definitions |
An optically active form of ornithine having L-configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15729 |
|
| alternative term |
(S)-ornithine (S)-2,5-Diaminopentanoate (S)-2,5-Diaminopentanoic acid (S)-alpha,delta-diaminovaleric acid (S)-2,5-diaminovaleric acid L-ornithine (2S)-2,5-diaminopentanoic acid L-Ornithine |
|
| bearer of | ||
| charge |
0 |
|
| database_cross_reference |
Beilstein:1722298 Wikipedia:Ornithine PMID:18676473 PDBeChem:ORN KNApSAcK:C00001384 KEGG:C00077 Reaxys:1722298 Drug_Central:3401 PMID:19173225 HMDB:HMDB0000214 PMID:19083482 PMID:22387109 PMID:17190852 PMID:22033378 CAS:70-26-8 DrugBank:DB00129 MetaCyc:ORNITHINE PMID:22735334 PMID:22133808 KEGG:D08302 Gmelin:327282 PMID:15576628 |
|
| definition |
An optically active form of ornithine having L-configuration. |
|
| formula |
C5H12N2O2 |
|
| has_alternative_id |
CHEBI:21367 CHEBI:13148 CHEBI:6280 |
|
| has_exact_synonym |
L-ornithine (2S)-2,5-diaminopentanoic acid L-Ornithine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(S)-ornithine (S)-2,5-Diaminopentanoate (S)-2,5-Diaminopentanoic acid (S)-alpha,delta-diaminovaleric acid (S)-2,5-diaminovaleric acid |
|
| id |
CHEBI:15729 |
|
| in_subset | ||
| inchi |
InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1 |
|
| inchikey |
AHLPHDHHMVZTML-BYPYZUCNSA-N |
|
| is_conjugate_acid_of | ||
| is_conjugate_base_of | ||
| is_enantiomer_of | ||
| label |
L-ornithine |
|
| mass |
132.16106 |
|
| monoisotopicmass |
132.08988 |
|
| notation |
CHEBI:15729 |
|
| prefLabel |
L-ornithine |
|
| RO_0000087 | ||
| smiles |
NCCC[C@H](N)C(O)=O |
|
| subClassOf |