loading...| Preferred Name |
glutathione |
| Synonyms |
5-L-Glutamyl-L-cysteinylglycine Reduced glutathione gamma-L-Glutamyl-L-cysteinyl-glycine GSH L-gamma-glutamyl-L-cysteinylglycine Glutathione-SH Glutathione N-(N-gamma-L-Glutamyl-L-cysteinyl)glycine |
| Definitions |
A tripeptide compound consisting of glutamic acid attached via its side chain to the N-terminus of cysteinylglycine. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_16856 |
| charge |
0 |
| database_cross_reference |
KEGG:D00014 PMID:4745654 KNApSAcK:C00001518 PMID:4200890 Drug_Central:1312 PMID:17439666 PDBeChem:GSH Wikipedia:Glutathione CAS:70-18-8 KEGG:C00051 Reaxys:1729812 MetaCyc:GLUTATHIONE DrugBank:DB00143 HMDB:HMDB0000125 |
| definition |
A tripeptide compound consisting of glutamic acid attached via its side chain to the N-terminus of cysteinylglycine. |
| formula |
C10H17N3O6S |
| has role |
http://purl.obolibrary.org/obo/CHEBI_22586 http://purl.obolibrary.org/obo/CHEBI_23357 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_85046 |
| has_alternative_id |
CHEBI:12402 CHEBI:5437 CHEBI:24334 CHEBI:43049 CHEBI:42873 CHEBI:14327 |
| has_exact_synonym |
L-gamma-glutamyl-L-cysteinylglycine Glutathione |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
5-L-Glutamyl-L-cysteinylglycine Reduced glutathione gamma-L-Glutamyl-L-cysteinyl-glycine GSH Glutathione-SH N-(N-gamma-L-Glutamyl-L-cysteinyl)glycine |
| id |
CHEBI:16856 |
| in_subset | |
| inchi |
InChI=1S/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
| inchikey |
RWSXRVCMGQZWBV-WDSKDSINSA-N |
| is conjugate acid of | |
| label |
glutathione |
| mass |
307.325 |
| monoisotopicmass |
307.084 |
| notation |
CHEBI:16856 |
| prefLabel |
glutathione |
| smiles |
N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)O |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_47923 |