Preferred Name |
citric acid |
|
Synonyms |
CITRIC ACID Citric acid 2-hydroxypropane-1,2,3-tricarboxylic acid Citronensaeure 3-Carboxy-3-hydroxypentane-1,5-dioic acid 2-Hydroxy-1,2,3-propanetricarboxylic acid 2-Hydroxytricarballylic acid E330 H3cit |
|
Definitions |
A tricarboxylic acid that is propane-1,2,3-tricarboxylic acid bearing a hydroxy substituent at position 2. It is an important metabolite in the pathway of all aerobic organisms. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30769 |
|
charge |
0 |
|
database_cross_reference |
KNApSAcK:C00007619 Drug_Central:666 PMID:11782123 PMID:22509852 Gmelin:4240 PMID:22192423 PMID:14537820 CAS:77-92-9 Wikipedia:Citric_Acid PDBeChem:CIT PMID:17604395 HMDB:HMDB0000094 PMID:18960216 PMID:22115968 MetaCyc:CIT PMID:17190852 PMID:22264346 PMID:18298573 PMID:19288211 PMID:16232627 PMID:15311880 PMID:11857437 KEGG:D00037 KEGG:C00158 PMID:22373571 PMID:17357118 DrugBank:DB04272 Reaxys:782061 PMID:15934243 Beilstein:782061 PMID:11762832 BPDB:1359 |
|
definition |
A tricarboxylic acid that is propane-1,2,3-tricarboxylic acid bearing a hydroxy substituent at position 2. It is an important metabolite in the pathway of all aerobic organisms. |
|
formula |
C6H8O7 |
|
has exact synonym |
CITRIC ACID Citric acid 2-hydroxypropane-1,2,3-tricarboxylic acid |
|
has related synonym |
Citronensaeure 3-Carboxy-3-hydroxypentane-1,5-dioic acid 2-Hydroxy-1,2,3-propanetricarboxylic acid 2-Hydroxytricarballylic acid E330 H3cit |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_64049 http://purl.obolibrary.org/obo/CHEBI_33281 |
|
has_alternative_id |
CHEBI:23322 CHEBI:41523 CHEBI:3727 |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:30769 |
|
in_subset | ||
inchi |
InChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
|
inchikey |
KRKNYBCHXYNGOX-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
citric acid |
|
mass |
192.123 |
|
monoisotopicmass |
192.02700 |
|
notation |
CHEBI:30769 |
|
prefLabel |
citric acid |
|
smiles |
OC(=O)CC(O)(CC(O)=O)C(O)=O |
|
subClassOf |