Preferred Name |
serotonin |
|
Synonyms |
3-(2-aminoethyl)-1H-indol-5-ol SEROTONIN Serotonin InChIKey=QZAYGJVTTNCVMB-UHFFFAOYSA-N InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2 5-Hydroxytryptamine thrombocytin 3-(2-Aminoethyl)-1H-indol-5-ol thrombotonin NCCc1c[nH]c2ccc(O)cc12 5-HT C10H12N2O Enteramine serotonine |
|
Definitions |
The 5-hydroxy derivative of tryptamine. A primary amino compound that is the 5-hydroxy derivative of tryptamine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28790 |
|
charge |
0 |
|
database_cross_reference |
PMID:18593914 PMID:24136337 KEGG:C00780 Wikipedia:Serotonin MetaCyc:SEROTONIN LINCS:LSM-6589 Reaxys:143524 Beilstein:143524 CAS:50-67-9 PDBeChem:SRO Gmelin:1861995 PMID:22770225 HMDB:HMDB0000259 KNApSAcK:C00001429 |
|
definition |
The 5-hydroxy derivative of tryptamine. A primary amino compound that is the 5-hydroxy derivative of tryptamine. |
|
formula |
C10H12N2O |
|
has exact synonym |
3-(2-aminoethyl)-1H-indol-5-ol SEROTONIN Serotonin |
|
has functional parent | ||
has related synonym |
InChIKey=QZAYGJVTTNCVMB-UHFFFAOYSA-N InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2 5-Hydroxytryptamine thrombocytin 3-(2-Aminoethyl)-1H-indol-5-ol thrombotonin NCCc1c[nH]c2ccc(O)cc12 5-HT C10H12N2O Enteramine serotonine |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_25512 |
|
has_alternative_id |
CHEBI:26652 CHEBI:49894 CHEBI:1420 |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:28790 |
|
in_subset | ||
inchi |
InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2 |
|
inchikey |
QZAYGJVTTNCVMB-UHFFFAOYSA-N |
|
is conjugate base of | ||
label |
serotonin |
|
mass |
176.215 |
|
monoisotopicmass |
176.09496 |
|
notation |
CHEBI:28790 |
|
prefLabel |
serotonin |
|
smiles |
C1=CC(=CC=2C(=CNC12)CCN)O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_27162 http://purl.obolibrary.org/obo/CHEBI_33853 http://purl.obolibrary.org/obo/CHEBI_84729 |