Preferred Name |
|
|
Synonyms |
L-Cysteine L-cysteine (2R)-2-amino-3-sulfanylpropanoic acid (R)-2-amino-3-mercaptopropanoic acid L-2-Amino-3-mercaptopropionic acid FREE CYSTEINE (2R)-2-amino-3-mercaptopropanoic acid C CYSTEINE Cys E 920 E-920 E920 L-Cystein L-Zystein |
|
Definitions |
An optically active form of cysteine having L-configuration. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17561 |
|
charge |
0 |
|
database_cross_reference |
Beilstein:1721408 PDBeChem:CYS YMDB:YMDB00046 DrugBank:DB00151 Wikipedia:Cysteine CAS:52-90-4 HMDB:HMDB0000574 MetaCyc:CYS KNApSAcK:C00001351 PMID:13761469 KEGG:D00026 Gmelin:49991 PMID:22735334 KEGG:C00097 PMID:11732994 Drug_Central:769 ECMDB:ECMDB00574 Reaxys:1721408 |
|
definition |
An optically active form of cysteine having L-configuration. |
|
formula |
C3H7NO2S |
|
has exact synonym |
L-Cysteine L-cysteine |
|
has related synonym |
(2R)-2-amino-3-sulfanylpropanoic acid (R)-2-amino-3-mercaptopropanoic acid L-2-Amino-3-mercaptopropionic acid FREE CYSTEINE (2R)-2-amino-3-mercaptopropanoic acid C CYSTEINE Cys E 920 E-920 E920 L-Cystein L-Zystein |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_77703 |
|
has_alternative_id |
CHEBI:41781 CHEBI:21261 CHEBI:41768 CHEBI:41227 CHEBI:13095 CHEBI:41811 CHEBI:41700 CHEBI:6207 |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:17561 |
|
in_subset | ||
inchi |
InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1 |
|
inchikey |
XUJNEKJLAYXESH-REOHCLBHSA-N |
|
is conjugate acid of | ||
is conjugate base of | ||
is enantiomer of | ||
is tautomer of | ||
label |
L-cysteine |
|
mass |
121.15800 |
|
monoisotopicmass |
121.01975 |
|
notation |
CHEBI:17561 |
|
smiles |
N[C@@H](CS)C(O)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83813 http://purl.obolibrary.org/obo/CHEBI_15705 |