Preferred Name |
all-trans-retinol |
|
Synonyms |
all-trans-Retinol all-trans-retinol all-trans-retinyl alcohol trans-retinol (all-E)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraen-1-ol all-trans retinol all-trans-vitamin A all-trans-vitamin A alcohol retinol (vit A) (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-ol vitamin A alcohol vitamin A1 alcohol Alphalin Aquasol A Chocola A Vitamin A1 retinol retinolum vitamin A vitamin A1 |
|
Definitions |
A retinol in which all four exocyclic double bonds have E- (trans-) geometry. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17336 |
|
charge |
0 |
|
database_cross_reference |
PMID:15531678 PMID:16469975 Beilstein:403040 PMID:12221269 Wikipedia:Retinol Gmelin:247497 PMID:25478840 PMID:17790232 LIPID_MAPS_instance:LMPR01090001 PMID:8464067 PDBeChem:RTL PMID:12074187 Drug_Central:2831 CAS:68-26-8 CAS:11103-57-4 KEGG:C17276 PMID:9736606 KEGG:D06543 DrugBank:DB00162 PMID:7971717 PMID:10637381 Chemspider:393012 PMID:22444309 PMID:12600856 PMID:30510477 PMID:12548314 PMID:15622799 PMID:16507353 PMID:19264891 PMID:16825693 PMID:15051608 PMID:31484771 KEGG:D00069 PMID:8496140 PMID:20697621 PMID:2295828 HMDB:HMDB0000305 PMID:1414975 MetaCyc:CPD-13524 PMID:2217163 KEGG:C00473 PMID:12229281 KNApSAcK:C00031437 PMID:9155646 PMID:15041701 PMID:15929633 |
|
definition |
A retinol in which all four exocyclic double bonds have E- (trans-) geometry. |
|
formula |
C20H30O |
|
has exact synonym |
all-trans-Retinol all-trans-retinol |
|
has related synonym |
all-trans-retinyl alcohol trans-retinol (all-E)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraen-1-ol all-trans retinol all-trans-vitamin A all-trans-vitamin A alcohol retinol (vit A) (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-ol vitamin A alcohol vitamin A1 alcohol Alphalin Aquasol A Chocola A Vitamin A1 retinol retinolum vitamin A vitamin A1 |
|
has role | ||
has_alternative_id |
CHEBI:12783 CHEBI:22349 CHEBI:8816 |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:17336 |
|
in_subset | ||
inchi |
InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3/b9-6+,12-11+,16-8+,17-13+ |
|
inchikey |
FPIPGXGPPPQFEQ-OVSJKPMPSA-N |
|
label |
all-trans-retinol |
|
mass |
286.459 |
|
monoisotopicmass |
286.22967 |
|
notation |
CHEBI:17336 |
|
prefLabel |
all-trans-retinol |
|
smiles |
C\C(=C/CO)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C |
|
subClassOf |