Preferred Name |
octopamine |
|
Synonyms |
4-(2-amino-1-hydroxyethyl)phenol Octopamine alpha-(aminomethyl)-p-hydroxybenzyl alcohol 1-(p-hydroxyphenyl)-2-aminoethanol alpha-(aminomethyl)-4-hydroxybenzenemethanol 1-(4-Hydroxyphenyl)-2-aminoethanol norsynephrine beta-hydroxytyramine p-Hydroxyphenylethanolamine octopaminum Octopamin |
|
Definitions |
A member of the class of phenylethanolamines that is phenol which is substituted at the para- position by a 2-amino-1-hydroxyethyl group. A biogenic phenylethanolamine which has been found to act as a neurotransmitter, neurohormone or neuromodulator in invertebrates. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17134 |
|
charge |
0 |
|
database_cross_reference |
Beilstein:1211019 CAS:104-14-3 LINCS:LSM-4975 Drug_Central:3396 KEGG:C04227 |
|
definition |
A member of the class of phenylethanolamines that is phenol which is substituted at the para- position by a 2-amino-1-hydroxyethyl group. A biogenic phenylethanolamine which has been found to act as a neurotransmitter, neurohormone or neuromodulator in invertebrates. |
|
formula |
C8H11NO2 |
|
has exact synonym |
4-(2-amino-1-hydroxyethyl)phenol Octopamine |
|
has related synonym |
alpha-(aminomethyl)-p-hydroxybenzyl alcohol 1-(p-hydroxyphenyl)-2-aminoethanol alpha-(aminomethyl)-4-hydroxybenzenemethanol 1-(4-Hydroxyphenyl)-2-aminoethanol norsynephrine beta-hydroxytyramine p-Hydroxyphenylethanolamine octopaminum Octopamin |
|
has role | ||
has_alternative_id |
CHEBI:25655 CHEBI:11191 CHEBI:571 |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:17134 |
|
in_subset | ||
inchi |
InChI=1S/C8H11NO2/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4,8,10-11H,5,9H2 |
|
inchikey |
QHGUCRYDKWKLMG-UHFFFAOYSA-N |
|
is conjugate base of | ||
label |
octopamine |
|
mass |
153.17848 |
|
monoisotopicmass |
153.07898 |
|
notation |
CHEBI:17134 |
|
prefLabel |
octopamine |
|
smiles |
NCC(O)c1ccc(O)cc1 |
|
subClassOf |