Preferred Name |
beta-alanine |
|
Synonyms |
beta-Alanine BETA-ALANINE 3-aminopropanoic acid beta-alanine 3-Aminopropionic acid omega-aminopropionic acid H-beta-Ala-OH beta-aminopropionic acid bAla |
|
Definitions |
A naturally-occurring beta-amino acid comprising propionic acid with the amino group in the 3-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16958 |
|
charge |
0 |
|
database_cross_reference |
PMID:20994958 Reaxys:906793 DrugBank:DB03107 Beilstein:906793 PMID:19955842 PMID:12887142 PMID:19239140 MetaCyc:B-ALANINE PMID:14363188 HMDB:HMDB0000056 PMID:11850512 PMID:18613640 CAS:107-95-9 PMID:16934791 Wikipedia:Beta-Alanine Gmelin:49614 PMID:11139233 PMID:22735334 PMID:20479615 PMID:20386120 KEGG:C00099 PDBeChem:BAL PMID:12107759 KNApSAcK:C00001333 KEGG:D07561 PMID:20199122 PMID:18528519 |
|
definition |
A naturally-occurring beta-amino acid comprising propionic acid with the amino group in the 3-position. |
|
formula |
C3H7NO2 |
|
has exact synonym |
beta-Alanine BETA-ALANINE 3-aminopropanoic acid beta-alanine |
|
has related synonym |
3-Aminopropionic acid 3-aminopropanoic acid omega-aminopropionic acid H-beta-Ala-OH beta-aminopropionic acid bAla |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_25512 http://purl.obolibrary.org/obo/CHEBI_48705 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
has_alternative_id |
CHEBI:10343 CHEBI:12389 CHEBI:41050 CHEBI:22821 |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:16958 |
|
in_subset | ||
inchi |
InChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6) |
|
inchikey |
UCMIRNVEIXFBKS-UHFFFAOYSA-N |
|
is conjugate acid of | ||
is tautomer of | ||
label |
beta-alanine |
|
mass |
89.09322 |
|
monoisotopicmass |
89.04768 |
|
notation |
CHEBI:16958 |
|
prefLabel |
beta-alanine |
|
smiles |
NCCC(O)=O |
|
subClassOf |