Preferred Name |
ibuprofen |
|
Synonyms |
2-[4-(2-methylpropyl)phenyl]propanoic acid |
|
Definitions |
A monocarboxylic acid that is propionic acid in which one of the hydrogens at position 2 is substituted by a 4-(2-methylpropyl)phenyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5855 |
|
database_cross_reference |
CAS:15687-27-1 DrugBank:DB01050 |
|
definition |
A monocarboxylic acid that is propionic acid in which one of the hydrogens at position 2 is substituted by a 4-(2-methylpropyl)phenyl group. |
|
formula |
C13H18O2 |
|
has role | ||
has_exact_synonym |
2-[4-(2-methylpropyl)phenyl]propanoic acid |
|
label |
ibuprofen |
|
prefixIRI |
CHEBI:5855 |
|
prefLabel |
ibuprofen |
|
smiles |
CC(C)Cc1ccc(cc1)C(C)C(O)=O |
|
subClassOf |
Create mapping