Preferred Name |
fenofibrate |
|
Synonyms |
propan-2-yl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate |
|
Definitions |
A chlorobenzophenone that is (4-chlorophenyl)(phenyl)methanone substituted by a [2-methyl-1-oxo-1-(propan-2-yloxy)propan-2-yl]oxy group at position 1 on the phenyl ring. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5001 |
|
database_cross_reference |
LINCS:LSM-3107 |
|
definition |
A chlorobenzophenone that is (4-chlorophenyl)(phenyl)methanone substituted by a [2-methyl-1-oxo-1-(propan-2-yloxy)propan-2-yl]oxy group at position 1 on the phenyl ring. |
|
has_exact_synonym |
propan-2-yl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate |
|
label |
fenofibrate |
|
prefixIRI |
CHEBI:5001 |
|
prefLabel |
fenofibrate |
|
smiles |
CC(C)OC(=O)C(C)(C)Oc1ccc(cc1)C(=O)c1ccc(Cl)cc1 |
|
subClassOf |
Create mapping