Preferred Name |
linezolid |
|
Synonyms |
N-({(5S)-3-[3-fluoro-4-(morpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl)acetamide Linezolid N-(((S)-3-(3-Fluoro-4-morpholinophenyl)-2-oxo-5-oxazolidinyl)methyl)acetamide linezolid |
|
Definitions |
An organofluorine compound that consists of 1,3-oxazolidin-2-one bearing an N-3-fluoro-4-(morpholin-4-yl)phenyl group as well as an acetamidomethyl group at position 5. A synthetic antibacterial agent that inhibits bacterial protein synthesis by binding to a site on 23S ribosomal RNA of the 50S subunit and prevents further formation of a functional 70S initiation complex. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_63607 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Linezolid PMID:22214776 PMID:22247123 LINCS:LSM-5750 Patent:WO957271 PMID:22064533 PMID:22134348 Patent:US5688792 PMID:22230331 PMID:22139199 PDBeChem:ZLD PMID:21740298 PMID:22110086 Reaxys:7496939 Drug_Central:1584 PMID:21815204 PMID:22064542 CAS:165800-03-3 PMID:21899392 KEGG:D00947 DrugBank:DB00601 KEGG:C08146 PMID:22037854 |
|
formula |
C16H20FN3O4 |
|
has role | ||
has_alternative_id |
CHEBI:6477 |
|
has_exact_synonym |
N-({(5S)-3-[3-fluoro-4-(morpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl)acetamide Linezolid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
N-(((S)-3-(3-Fluoro-4-morpholinophenyl)-2-oxo-5-oxazolidinyl)methyl)acetamide linezolid |
|
id |
CHEBI:63607 |
|
in_subset | ||
inchi |
InChI=1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1 |
|
inchikey |
TYZROVQLWOKYKF-ZDUSSCGKSA-N |
|
label |
linezolid |
|
mass |
337.34610 |
|
monoisotopicmass |
337.14378 |
|
notation |
CHEBI:63607 |
|
prefLabel |
linezolid |
|
smiles |
CC(=O)NC[C@H]1CN(C(=O)O1)c1ccc(N2CCOCC2)c(F)c1 |
|
textual definition |
An organofluorine compound that consists of 1,3-oxazolidin-2-one bearing an N-3-fluoro-4-(morpholin-4-yl)phenyl group as well as an acetamidomethyl group at position 5. A synthetic antibacterial agent that inhibits bacterial protein synthesis by binding to a site on 23S ribosomal RNA of the 50S subunit and prevents further formation of a functional 70S initiation complex. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_37143 http://purl.obolibrary.org/obo/CHEBI_22160 |