loading...| Preferred Name |
fluorescein (lactone form) |
|
| Synonyms |
3',6'-dihydroxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one fluorescein lactone Solvent Yellow 94 D and C Yellow No. 7 Yellow fluorescein 3',6'-dihydroxyfluoran Japan Yellow 201 fluoresceine 9-(o-carboxyphenyl)-6-hydroxy-3H-xanthen-3-one Fluoreszein C.I. Solvent Yellow 94 D&C Yellow No. 7 resorcinolphthalein 3,6-fluorandiol 9-(o-carboxyphenyl)-6-hydroxy-3-isoxanthenone C.I. 45350 |
|
| Definitions |
A xanthene dye that is highly fluorescent, detectable even when present in minute quantities. Used forensically to detect traces of blood, in analytical chemistry as an indicator in silver nitrate titrations and in microscopy. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_31624 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:21443768 PMID:2508085 PMID:17076510 PMID:6192565 PMID:23737658 PMID:24756415 PMID:24614144 PMID:26744790 PMID:16195545 PMID:30772364 PMID:28781922 CAS:2321-07-5 PMID:7868912 PMID:8637844 PMID:16307475 PMID:29065823 PMID:1854691 PMID:33661250 PMID:20725378 Gmelin:248626 DrugBank:DB00693 PMID:8341496 PMID:15836438 KEGG:D01261 PMID:2104617 PMID:3937554 PMID:7873555 PMID:7696460 PMID:33838945 PMID:8030782 PMID:28490862 PMID:19603796 Chemspider:15968 PMID:1517825 PMID:15178254 PMID:13611166 PMID:27303817 PMID:27833927 PMID:24709799 PMID:26675489 PMID:26756394 PMID:9294871 PMID:15352064 PMID:17097086 PMID:15465055 PMID:23363235 PMID:12945055 PMID:26457839 Reaxys:94324 PMID:31620443 Beilstein:94324 HMDB:HMDB0014831 Wikipedia:Fluorescein PMID:20371259 PMID:29237120 PDB:4FAB |
|
| editor preferred term |
fluorescein (lactone form) |
|
| formula |
C20H12O5 |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_37338 |
|
| has_alternative_id |
CHEBI:606590 |
|
| has_exact_synonym |
3',6'-dihydroxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
fluorescein lactone Solvent Yellow 94 D and C Yellow No. 7 Yellow fluorescein 3',6'-dihydroxyfluoran Japan Yellow 201 fluoresceine 9-(o-carboxyphenyl)-6-hydroxy-3H-xanthen-3-one Fluoreszein C.I. Solvent Yellow 94 D&C Yellow No. 7 resorcinolphthalein 3,6-fluorandiol 9-(o-carboxyphenyl)-6-hydroxy-3-isoxanthenone C.I. 45350 |
|
| has_RxCUI |
25138 |
|
| id |
CHEBI:31624 |
|
| imported from | ||
| in_subset | ||
| inchi |
InChI=1S/C20H12O5/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20/h1-10,21-22H |
|
| inchikey |
GNBHRKFJIUUOQI-UHFFFAOYSA-N |
|
| label |
fluorescein (lactone form) Fluorescein |
|
| mass |
332.311 |
|
| monoisotopicmass |
332.06847 |
|
| notation |
CHEBI:31624 |
|
| prefixIRI |
CHEBI:31624 |
|
| prefLabel |
fluorescein (lactone form) |
|
| smiles |
OC1=CC=C2C(OC3=CC(O)=CC=C3C22OC(=O)C3=C2C=CC=C3)=C1 |
|
| textual definition |
A xanthene dye that is highly fluorescent, detectable even when present in minute quantities. Used forensically to detect traces of blood, in analytical chemistry as an indicator in silver nitrate titrations and in microscopy. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_37929 http://purl.obolibrary.org/obo/CHEBI_38831 http://purl.obolibrary.org/obo/CHEBI_38164 http://purl.obolibrary.org/obo/CHEBI_37948 http://purl.obolibrary.org/obo/CHEBI_23367 |