loading...| Preferred Name |
ropinirole |
|
| Synonyms |
Ropinirole 4-[2-(dipropylamino)ethyl]-1,3-dihydro-2H-indol-2-one ropinirolum InChIKey=UHSKFQJFRQCDBE-UHFFFAOYSA-N CCCN(CCC)CCc1cccc2NC(=O)Cc12 InChI=1S/C16H24N2O/c1-3-9-18(10-4-2)11-8-13-6-5-7-15-14(13)12-16(19)17-15/h5-7H,3-4,8-12H2,1-2H3,(H,17,19) ropinirole ropinirol C16H24N2O |
|
| Definitions |
An indolone that has formula C16H24N2O. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8888 |
|
| database_cross_reference |
Patent:US4452808 Wikipedia:Ropinirole ChemIDplus:91374-21-9 DrugBank:DB00268 Beilstein:6062222 KEGG COMPOUND:C07564 |
|
| definition |
An indolone that has formula C16H24N2O. |
|
| has_exact_synonym |
Ropinirole 4-[2-(dipropylamino)ethyl]-1,3-dihydro-2H-indol-2-one |
|
| has_related_synonym |
ropinirolum InChIKey=UHSKFQJFRQCDBE-UHFFFAOYSA-N CCCN(CCC)CCc1cccc2NC(=O)Cc12 InChI=1S/C16H24N2O/c1-3-9-18(10-4-2)11-8-13-6-5-7-15-14(13)12-16(19)17-15/h5-7H,3-4,8-12H2,1-2H3,(H,17,19) ropinirole ropinirol C16H24N2O |
|
| has_RxCUI |
72302 |
|
| id |
CHEBI:8888 |
|
| imported from | ||
| label |
ropinirole |
|
| notation |
CHEBI:8888 |
|
| prefLabel |
ropinirole |
|
| subClassOf |