Preferred Name |
caffeic acid |
|
Synonyms |
3-(3,4-dihydroxyphenyl)prop-2-enoic acid OC(=O)C=Cc1ccc(O)c(O)c1 180.15740 InChI=1S/C9H8O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5,10-11H,(H,12,13) QAIPRVGONGVQAS-UHFFFAOYSA-N C9H8O4 |
|
Definitions |
A hydroxycinnamic acid that is cinnamic acid in which the phenyl ring is substituted by hydroxy groups at positions 3 and 4. It exists in cis and trans forms; the latter is the more common. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_36281 |
|
database_cross_reference |
PMID:15778121 PMID:18061431 PMID:18482095 Beilstein:2210883 HMDB:HMDB01964 PMID:8340025 Reaxys:2210883 KEGG:C01481 PMID:11373473 LINCS:LSM-5272 PMID:18314336 PMID:20542693 |
|
definition |
A hydroxycinnamic acid that is cinnamic acid in which the phenyl ring is substituted by hydroxy groups at positions 3 and 4. It exists in cis and trans forms; the latter is the more common. |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_64964 http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_76797 http://purl.obolibrary.org/obo/CHEBI_22586 |
|
has_exact_synonym |
3-(3,4-dihydroxyphenyl)prop-2-enoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
OC(=O)C=Cc1ccc(O)c(O)c1 180.15740 InChI=1S/C9H8O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5,10-11H,(H,12,13) QAIPRVGONGVQAS-UHFFFAOYSA-N C9H8O4 |
|
id |
CHEBI:36281 |
|
imported from | ||
label |
caffeic acid |
|
notation |
CHEBI:36281 |
|
prefLabel |
caffeic acid |
|
subClassOf |