loading...| Preferred Name |
dodecanoic acid |
|
| Synonyms |
dodecanoic acid Dodecanoic acid C12H24O2 CCCCCCCCCCCC(O)=O Laurostearic acid Dodecylcarboxylate C12 fatty acid Laurinsaeure Duodecyclic acid N-dodecanoic acid ABL Duodecylic acid 200.31780 DAO Undecane-1-carboxylic acid C12:0 InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14) POULHZVOKOAJMA-UHFFFAOYSA-N Coconut oil fatty acids dodecoic acid lauric acid LAURIC ACID n-dodecanoic acid 1-undecanecarboxylic acid Vulvic acid Dodecylic acid CH3-[CH2]10-COOH Lauric acid |
|
| Definitions |
A straight-chain, twelve-carbon medium-chain saturated fatty acid with strong bactericidal properties; the main fatty acid in coconut oil and palm kernel oil. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30805 |
|
| database_cross_reference |
Gmelin:103520 KNApSAcK:C00001221 Wikipedia:Lauric_acid Reaxys:1099477 PMID:19387482 UM-BBD_compID:c0566 PMID:26884207 HMDB:HMDB00638 CAS:143-07-7 KEGG:C02679 PDBeChem:DAO DrugBank:DB03017 LIPID_MAPS_instance:LMFA01010012 MetaCyc:DODECANOATE Beilstein:1099477 |
|
| definition |
A straight-chain, twelve-carbon medium-chain saturated fatty acid with strong bactericidal properties; the main fatty acid in coconut oil and palm kernel oil. |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
| has_alternative_id |
CHEBI:4680 CHEBI:23864 CHEBI:23865 CHEBI:41882 |
|
| has_exact_synonym |
dodecanoic acid Dodecanoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
C12H24O2 CCCCCCCCCCCC(O)=O Laurostearic acid Dodecylcarboxylate C12 fatty acid Laurinsaeure Duodecyclic acid N-dodecanoic acid ABL Duodecylic acid 200.31780 DAO Undecane-1-carboxylic acid C12:0 InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14) POULHZVOKOAJMA-UHFFFAOYSA-N Coconut oil fatty acids dodecoic acid lauric acid LAURIC ACID n-dodecanoic acid 1-undecanecarboxylic acid Vulvic acid Dodecylic acid CH3-[CH2]10-COOH Lauric acid |
|
| id |
CHEBI:30805 |
|
| imported from | ||
| is conjugate acid of | ||
| label |
dodecanoic acid |
|
| notation |
CHEBI:30805 |
|
| prefLabel |
dodecanoic acid |
|
| subClassOf |