Preferred Name |
fumaric acid |
|
Synonyms |
FUMARIC ACID (2E)-but-2-enedioic acid Fumaric acid trans-1,2-ethylenedicarboxylic acid (2E)-2-butenedioic acid 116.07220 C4H4O4 InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+ OC(=O)\C=C\C(O)=O trans-but-2-enedioic acid Fumarsaeure trans-Butenedioic acid VZCYOOQTPOCHFL-OWOJBTEDSA-N E297 (E)-2-butenedioic acid |
|
Definitions |
A butenedioic acid in which the C=C double bond has E geometry. It is an intermediate metabolite in the citric acid cycle. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_18012 |
|
database_cross_reference |
PDBeChem:FUM MetaCyc:FUM PMID:21414846 PMID:22113915 Gmelin:49855 PMID:17439666 PMID:22217732 CAS:110-17-8 Wikipedia:Fumaric_Acid PMID:22516248 Beilstein:605763 HMDB:HMDB00134 Reaxys:605763 KNApSAcK:C00001183 KEGG:D02308 KEGG:C00122 |
|
definition |
A butenedioic acid in which the C=C double bond has E geometry. It is an intermediate metabolite in the citric acid cycle. |
|
has role | ||
has_alternative_id |
CHEBI:24124 CHEBI:5190 CHEBI:42743 |
|
has_exact_synonym |
FUMARIC ACID (2E)-but-2-enedioic acid Fumaric acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
trans-1,2-ethylenedicarboxylic acid (2E)-2-butenedioic acid 116.07220 C4H4O4 InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+ OC(=O)\C=C\C(O)=O trans-but-2-enedioic acid Fumarsaeure trans-Butenedioic acid VZCYOOQTPOCHFL-OWOJBTEDSA-N E297 (E)-2-butenedioic acid |
|
id |
CHEBI:18012 |
|
imported from | ||
is conjugate acid of | ||
label |
fumaric acid |
|
notation |
CHEBI:18012 |
|
prefLabel |
fumaric acid |
|
subClassOf |