Preferred Name |
erythritol |
|
Synonyms |
Erythritol meso-erythritol erythritol Phycitol InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2/t3-,4+ MESO-ERYTHRITOL 122.11980 Phycite L-erythritol OC[C@H](O)[C@H](O)CO UNXHWFMMPAWVPI-ZXZARUISSA-N erythro-tetritol Erythrol mesoerythritol Erythrite Erythrit C4H10O4 (2R,3S)-butane-1,2,3,4-tetrol |
|
Definitions |
The meso-diastereomer of butane-1,2,3,4-tetrol. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17113 |
|
database_cross_reference |
KNApSAcK:C00001161 KEGG:C00503 PMID:23421980 Gmelin:82499 PMID:22770225 CAS:149-32-6 PMID:17336832 PMID:12639570 PMID:19632091 PMID:163226 PMID:23890177 Wikipedia:Erythritol Reaxys:1735878 PMID:9862657 PMID:16901854 MetaCyc:ERYTHRITOL HMDB:HMDB02994 PMID:18369603 PMID:17979222 Beilstein:1719753 DrugBank:DB04481 PDBeChem:MRY PMID:23574577 |
|
definition |
The meso-diastereomer of butane-1,2,3,4-tetrol. |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
has_alternative_id |
CHEBI:14215 CHEBI:23946 CHEBI:372804 CHEBI:4840 CHEBI:44263 |
|
has_exact_synonym |
Erythritol meso-erythritol erythritol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Phycitol InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2/t3-,4+ MESO-ERYTHRITOL 122.11980 Phycite L-erythritol OC[C@H](O)[C@H](O)CO UNXHWFMMPAWVPI-ZXZARUISSA-N erythro-tetritol Erythrol mesoerythritol Erythrite Erythrit C4H10O4 (2R,3S)-butane-1,2,3,4-tetrol |
|
id |
CHEBI:17113 |
|
imported from | ||
label |
erythritol |
|
notation |
CHEBI:17113 |
|
prefLabel |
erythritol |
|
subClassOf |