Preferred Name |
melatonin |
|
Synonyms |
Melatonin N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide melatonin COc1ccc2[nH]cc(CCNC(C)=O)c2c1 5-methoxy-N-acetyltryptamine N-[2-(5-methoxyindol-3-yl)ethyl]acetamide C13H16N2O2 InChI=1S/C13H16N2O2/c1-9(16)14-6-5-10-8-15-13-4-3-11(17-2)7-12(10)13/h3-4,7-8,15H,5-6H2,1-2H3,(H,14,16) 232.27830 melatonine N-Acetyl-5-methoxytryptamine DRLFMBDRBRZALE-UHFFFAOYSA-N |
|
Definitions |
A member of the class of acetamides that is acetamide in which one of the hydrogens attached to the nitrogen atom is replaced by a 2-(5-methoxy-1H-indol-3-yl)ethyl group. It is a hormone secreted by the pineal gland in humans. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16796 |
|
database_cross_reference |
KEGG:C01598 PMID:18212404 DrugBank:DB01065 HMDB:HMDB01389 PMID:16678784 CAS:73-31-4 Beilstein:205542 Reaxys:205542 PMID:18485664 MetaCyc:N-ACETYL-5-METHOXY-TRYPTAMINE PDBeChem:ML1 KEGG:D08170 LINCS:LSM-4779 Wikipedia:Melatonin |
|
definition |
A member of the class of acetamides that is acetamide in which one of the hydrogens attached to the nitrogen atom is replaced by a 2-(5-methoxy-1H-indol-3-yl)ethyl group. It is a hormone secreted by the pineal gland in humans. |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_50847 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_35488 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_24621 |
|
has_alternative_id |
CHEBI:14577 CHEBI:6730 CHEBI:25180 |
|
has_exact_synonym |
Melatonin N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide melatonin |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
COc1ccc2[nH]cc(CCNC(C)=O)c2c1 5-methoxy-N-acetyltryptamine N-[2-(5-methoxyindol-3-yl)ethyl]acetamide C13H16N2O2 InChI=1S/C13H16N2O2/c1-9(16)14-6-5-10-8-15-13-4-3-11(17-2)7-12(10)13/h3-4,7-8,15H,5-6H2,1-2H3,(H,14,16) 232.27830 melatonine N-Acetyl-5-methoxytryptamine DRLFMBDRBRZALE-UHFFFAOYSA-N |
|
id |
CHEBI:16796 |
|
imported from | ||
label |
melatonin |
|
notation |
CHEBI:16796 |
|
prefLabel |
melatonin |
|
subClassOf |