loading...| Preferred Name |
limonene |
|
| Synonyms |
1-methyl-4-(prop-1-en-2-yl)cyclohex-1-ene Limonene p-mentha-1,8-diene limonene InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3 4-isopropenyl-1-methylcyclohexene Cajeputene 1,8-p-menthadiene (+-)-(RS)-limonene dl-Limonene Kautschin 136.23404 (+/-)-limonene CC(=C)C1CCC(C)=CC1 C10H16 XMGQYMWWDOXHJM-UHFFFAOYSA-N Dipentene 1-methyl-4-(1-methylethenyl)cyclohexene |
|
| Definitions |
A monoterpene that is cyclohex-1-ene substituted by a methyl group at position 1 and a prop-1-en-2-yl group at position 4 respectively. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15384 |
|
| database_cross_reference |
CAS:7705-14-8 KNApSAcK:C00003043 Reaxys:774123 UM-BBD_compID:c0626 KNApSAcK:C00000823 CAS:138-86-3 KEGG:C06078 |
|
| definition |
A monoterpene that is cyclohex-1-ene substituted by a methyl group at position 1 and a prop-1-en-2-yl group at position 4 respectively. |
|
| has parent hydride | ||
| has role | ||
| has_alternative_id |
CHEBI:14506 CHEBI:6463 CHEBI:18466 |
|
| has_exact_synonym |
1-methyl-4-(prop-1-en-2-yl)cyclohex-1-ene Limonene p-mentha-1,8-diene limonene |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3 4-isopropenyl-1-methylcyclohexene Cajeputene 1,8-p-menthadiene (+-)-(RS)-limonene dl-Limonene Kautschin 136.23404 (+/-)-limonene CC(=C)C1CCC(C)=CC1 C10H16 XMGQYMWWDOXHJM-UHFFFAOYSA-N Dipentene 1-methyl-4-(1-methylethenyl)cyclohexene |
|
| id |
CHEBI:15384 |
|
| imported from | ||
| label |
limonene |
|
| notation |
CHEBI:15384 |
|
| prefLabel |
limonene |
|
| subClassOf |