Preferred Name |
cysteine |
|
Synonyms |
cysteine Cysteine InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) C cisteina 2-amino-3-sulfanylpropanoic acid 121.15922 C3H7NO2S 2-Amino-3-mercaptopropionic acid Cys NC(CS)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N Zystein 2-amino-3-mercaptopropanoic acid Hcys Cystein |
|
Definitions |
A sulfur-containing amino acid that is propanoic acid with an amino group at position 2 and a sulfanyl group at position 3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15356 |
|
database_cross_reference |
Wikipedia:Cysteine KEGG:C00736 CAS:3374-22-9 KNApSAcK:C00001351 Gmelin:2933 KNApSAcK:C00007323 PMID:17439666 Reaxys:1721406 Beilstein:1721406 PMID:25181601 |
|
definition |
A sulfur-containing amino acid that is propanoic acid with an amino group at position 2 and a sulfanyl group at position 3. |
|
has part | ||
has role | ||
has_alternative_id |
CHEBI:23508 CHEBI:4050 CHEBI:14061 |
|
has_exact_synonym |
cysteine Cysteine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) C cisteina 2-amino-3-sulfanylpropanoic acid 121.15922 C3H7NO2S 2-Amino-3-mercaptopropionic acid Cys NC(CS)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N Zystein 2-amino-3-mercaptopropanoic acid Hcys Cystein |
|
id |
CHEBI:15356 |
|
imported from | ||
is conjugate acid of | ||
is conjugate base of | ||
is tautomer of | ||
label |
cysteine |
|
notation |
CHEBI:15356 |
|
prefLabel |
cysteine |
|
subClassOf |