Jump to:
loading...| Preferred Name |
skatole |
|
| Synonyms |
|
|
| Definitions |
A methylindole carrying a methyl substituent at position 3. It is produced during the anoxic metabolism of L-tryptophan in the mammalian digestive tract. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9171 |
|
| charge |
0 |
|
| definition |
A methylindole carrying a methyl substituent at position 3. It is produced during the anoxic metabolism of L-tryptophan in the mammalian digestive tract. |
|
| formula |
C9H9N |
|
| has role | ||
| inchi |
InChI=1S/C9H9N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6,10H,1H3 |
|
| inchikey |
ZFRKQXVRDFCRJG-UHFFFAOYSA-N |
|
| label |
skatole |
|
| mass |
131.17450 |
|
| monoisotopicmass |
131.07350 |
|
| prefixIRI |
CHEBI:9171 |
|
| prefLabel |
skatole |
|
| smiles |
Cc1c[nH]c2ccccc12 |
|
| subClassOf |
Create mapping